C22H28F3N5O — CID 111420341
2-(dimethylamino)-N-[3-[[[ethylamino-[[4-(trifluoromethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide (PubChem CID 111420341) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[ethylamino-[[4-(trifluoromethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[[4-(trifluoromethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111420341 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[[4-(trifluoromethyl)phenyl]methylamino]methylidene]amino]methyl]phenyl]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CN(C)C)c1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H28F3N5O/c1-4-26-21(27-13-16-8-10-18(11-9-16)22(23,24)25)28-14-17-6-5-7-19(12-17)29-20(31)15-30(2)3/h5-12H,4,13-15H2,1-3H3,(H,29,31)(H2,26,27,28) |
| InChIKey | HXMUOEXFGBREJP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|