C21H29FIN5O — CID 111231734
2-(dimethylamino)-N-[3-[[[ethylamino-[(4-fluorophenyl)methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111231734) has the molecular formula C21H29FIN5O and a molecular weight of 513.40 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[ethylamino-[(4-fluorophenyl)methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[(4-fluorophenyl)methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111231734 |
| Molecular Formula | C21H29FIN5O |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[ethylamino-[(4-fluorophenyl)methylamino]methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)CN(C)C)c1)NCc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H28FN5O.HI/c1-4-23-21(24-13-16-8-10-18(22)11-9-16)25-14-17-6-5-7-19(12-17)26-20(28)15-27(2)3;/h5-12H,4,13-15H2,1-3H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | SOSSOTVIFZPYJH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|