C17H24F3N5 — CID 21492926
(1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-cyclooctylguanidine (PubChem CID 21492926) has the molecular formula C17H24F3N5 and a molecular weight of 355.41 g/mol. Its IUPAC name is (1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-cyclooctylguanidine.
| Compound Name | (1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-cyclooctylguanidine |
|---|---|
| PubChem CID | 21492926 |
| Molecular Formula | C17H24F3N5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-cyclooctylguanidine |
| SMILES | NC(=N\C1CCCCCCC1)/N=C(\N)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H24F3N5/c18-17(19,20)12-8-10-14(11-9-12)24-16(22)25-15(21)23-13-6-4-2-1-3-5-7-13/h8-11,13H,1-7H2,(H5,21,22,23,24,25) |
| InChIKey | REJRWTDGWAAZMJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|