C11H15FN6 — CID 123628024
1-[amino-[(6-fluoro-3-pyridinyl)amino]methylidene]-2-cyclobutylguanidine (PubChem CID 123628024) has the molecular formula C11H15FN6 and a molecular weight of 250.28 g/mol. Its IUPAC name is 1-[amino-[(6-fluoro-3-pyridinyl)amino]methylidene]-2-cyclobutylguanidine.
| Compound Name | 1-[amino-[(6-fluoro-3-pyridinyl)amino]methylidene]-2-cyclobutylguanidine |
|---|---|
| PubChem CID | 123628024 |
| Molecular Formula | C11H15FN6 |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-[amino-[(6-fluoro-3-pyridinyl)amino]methylidene]-2-cyclobutylguanidine |
| SMILES | NC(=N/C(N)=N/C1CCC1)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C11H15FN6/c12-9-5-4-8(6-15-9)17-11(14)18-10(13)16-7-2-1-3-7/h4-7H,1-3H2,(H5,13,14,16,17,18) |
| InChIKey | JMFJIZFSVRFCME-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|