C13H20IN3O2 — CID 119146746
2-cyclobutyl-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 119146746) has the molecular formula C13H20IN3O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-cyclobutyl-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-cyclobutyl-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119146746 |
| Molecular Formula | C13H20IN3O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-cyclobutyl-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/C2CCC2)cc1OC.I |
| InChI | InChI=1S/C13H19N3O2.HI/c1-17-11-7-6-10(8-12(11)18-2)16-13(14)15-9-4-3-5-9;/h6-9H,3-5H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | OCIQPQSTGHDLRL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|