C17H25N3O2 — CID 120514400
1-(3,4-dimethoxyphenyl)-2-spiro[3.4]octan-3-ylguanidine (PubChem CID 120514400) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-spiro[3.4]octan-3-ylguanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-spiro[3.4]octan-3-ylguanidine |
|---|---|
| PubChem CID | 120514400 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-spiro[3.4]octan-3-ylguanidine |
| SMILES | COc1ccc(N/C(N)=N/C2CCC23CCCC3)cc1OC |
| InChI | InChI=1S/C17H25N3O2/c1-21-13-6-5-12(11-14(13)22-2)19-16(18)20-15-7-10-17(15)8-3-4-9-17/h5-6,11,15H,3-4,7-10H2,1-2H3,(H3,18,19,20) |
| InChIKey | DYBKYLVYYGNHFP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|