C15H21F2N3O2 — CID 120665928
2-[(3,3-difluorocyclopentyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine (PubChem CID 120665928) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclopentyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine.
| Compound Name | 2-[(3,3-difluorocyclopentyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 120665928 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[(3,3-difluorocyclopentyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2CCC(F)(F)C2)cc1OC |
| InChI | InChI=1S/C15H21F2N3O2/c1-21-12-4-3-11(7-13(12)22-2)20-14(18)19-9-10-5-6-15(16,17)8-10/h3-4,7,10H,5-6,8-9H2,1-2H3,(H3,18,19,20) |
| InChIKey | CHSUWZPDIABYGT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|