C14H16F5N3O — CID 120665920
2-[(3,3-difluorocyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120665920) has the molecular formula C14H16F5N3O and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(3,3-difluorocyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120665920 |
| Molecular Formula | C14H16F5N3O |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[(3,3-difluorocyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CC1CCC(F)(F)C1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F5N3O/c15-13(16)6-5-9(7-13)8-21-12(20)22-10-1-3-11(4-2-10)23-14(17,18)19/h1-4,9H,5-8H2,(H3,20,21,22) |
| InChIKey | NJDMJRUFXKNUDM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|