C14H17F3N4O2 — CID 120606178
2-[(6-oxopiperidin-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 120606178) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[(6-oxopiperidin-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(6-oxopiperidin-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 120606178 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(6-oxopiperidin-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CC1CCCC(=O)N1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N4O2/c15-14(16,17)23-11-6-4-9(5-7-11)21-13(18)19-8-10-2-1-3-12(22)20-10/h4-7,10H,1-3,8H2,(H,20,22)(H3,18,19,21) |
| InChIKey | QPPWBFBRLKUNEV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|