C15H22F3IN4O3S — CID 111810051
2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111810051) has the molecular formula C15H22F3IN4O3S and a molecular weight of 522.33 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111810051 |
| Molecular Formula | C15H22F3IN4O3S |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCS(=O)(=O)NCC1CCC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N4O3S.HI/c16-15(17,18)25-13-6-4-12(5-7-13)22-14(19)20-8-9-26(23,24)21-10-11-2-1-3-11;/h4-7,11,21H,1-3,8-10H2,(H3,19,20,22);1H |
| InChIKey | ROZCBXFIRWHARW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|