C11H12F6IN3O — CID 111800799
1-[4-(trifluoromethoxy)phenyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111800799) has the molecular formula C11H12F6IN3O and a molecular weight of 443.13 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111800799 |
| Molecular Formula | C11H12F6IN3O |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCC(F)(F)F)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F6N3O.HI/c12-10(13,14)5-6-19-9(18)20-7-1-3-8(4-2-7)21-11(15,16)17;/h1-4H,5-6H2,(H3,18,19,20);1H |
| InChIKey | QZKORBCOHUNQEE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|