C12H17F3IN3O3S — CID 111067181
2-(3-methylsulfonylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111067181) has the molecular formula C12H17F3IN3O3S and a molecular weight of 467.25 g/mol. Its IUPAC name is 2-(3-methylsulfonylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-(3-methylsulfonylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111067181 |
| Molecular Formula | C12H17F3IN3O3S |
| Molecular Weight | 467.25 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-(3-methylsulfonylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | CS(=O)(=O)CCC/N=C(\N)Nc1ccc(OC(F)(F)F)cc1.I |
| InChI | InChI=1S/C12H16F3N3O3S.HI/c1-22(19,20)8-2-7-17-11(16)18-9-3-5-10(6-4-9)21-12(13,14)15;/h3-6H,2,7-8H2,1H3,(H3,16,17,18);1H |
| InChIKey | XNQRERRYNDKZQV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|