C13H22IN3O4S — CID 111067185
1-(3,4-dimethoxyphenyl)-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111067185) has the molecular formula C13H22IN3O4S and a molecular weight of 443.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111067185 |
| Molecular Formula | C13H22IN3O4S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCS(C)(=O)=O)cc1OC.I |
| InChI | InChI=1S/C13H21N3O4S.HI/c1-19-11-6-5-10(9-12(11)20-2)16-13(14)15-7-4-8-21(3,17)18;/h5-6,9H,4,7-8H2,1-3H3,(H3,14,15,16);1H |
| InChIKey | CVTYUJJOVLRYAR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|