C12H17F3IN3O2 — CID 111800791
1-(3,4-dimethoxyphenyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111800791) has the molecular formula C12H17F3IN3O2 and a molecular weight of 419.19 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111800791 |
| Molecular Formula | C12H17F3IN3O2 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCC(F)(F)F)cc1OC.I |
| InChI | InChI=1S/C12H16F3N3O2.HI/c1-19-9-4-3-8(7-10(9)20-2)18-11(16)17-6-5-12(13,14)15;/h3-4,7H,5-6H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | PSKBOBKPIWUUCU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|