C17H22F3N5O3 — CID 111046685
1-(3,4-dimethoxyphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111046685) has the molecular formula C17H22F3N5O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111046685 |
| Molecular Formula | C17H22F3N5O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCC(O)(c2nccn2C)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C17H22F3N5O3/c1-25-9-8-22-14(25)16(26,17(18,19)20)6-7-23-15(21)24-11-4-5-12(27-2)13(10-11)28-3/h4-5,8-10,26H,6-7H2,1-3H3,(H3,21,23,24) |
| InChIKey | XEQSZIARAQQQKH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|