C13H20F3N5OS — CID 111046709
N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide (PubChem CID 111046709) has the molecular formula C13H20F3N5OS and a molecular weight of 351.40 g/mol. Its IUPAC name is N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111046709 |
| Molecular Formula | C13H20F3N5OS |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide |
| SMILES | Cn1ccnc1C(O)(CC/N=C(\N)N1CCSCC1)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N5OS/c1-20-5-4-18-10(20)12(22,13(14,15)16)2-3-19-11(17)21-6-8-23-9-7-21/h4-5,22H,2-3,6-9H2,1H3,(H2,17,19) |
| InChIKey | WZZKOOCAHNLZOG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|