C13H21F3IN5OS — CID 111046708
N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111046708) has the molecular formula C13H21F3IN5OS and a molecular weight of 479.31 g/mol. Its IUPAC name is N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111046708 |
| Molecular Formula | C13H21F3IN5OS |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cn1ccnc1C(O)(CC/N=C(\N)N1CCSCC1)C(F)(F)F.I |
| InChI | InChI=1S/C13H20F3N5OS.HI/c1-20-5-4-18-10(20)12(22,13(14,15)16)2-3-19-11(17)21-6-8-23-9-7-21;/h4-5,22H,2-3,6-9H2,1H3,(H2,17,19);1H |
| InChIKey | MGIGRJGELKLJFA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|