C18H29F3N6O3 — CID 111163531
ethyl 4-[N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163531) has the molecular formula C18H29F3N6O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163531 |
| Molecular Formula | C18H29F3N6O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H29F3N6O3/c1-4-22-15(26-10-12-27(13-11-26)16(28)30-5-2)24-7-6-17(29,18(19,20)21)14-23-8-9-25(14)3/h8-9,29H,4-7,10-13H2,1-3H3,(H,22,24) |
| InChIKey | JZEBSKNRDOVLFB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|