C20H33F3N6O — CID 111997011
1-ethyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111997011) has the molecular formula C20H33F3N6O and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-ethyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111997011 |
| Molecular Formula | C20H33F3N6O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 1-ethyl-3-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)NC1CC2CCCC(C1)N2C |
| InChI | InChI=1S/C20H33F3N6O/c1-4-24-18(27-14-12-15-6-5-7-16(13-14)29(15)3)26-9-8-19(30,20(21,22)23)17-25-10-11-28(17)2/h10-11,14-16,30H,4-9,12-13H2,1-3H3,(H2,24,26,27) |
| InChIKey | XCAACXIZUVUWHL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|