C19H35F3IN5O3 — CID 111989472
1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111989472) has the molecular formula C19H35F3IN5O3 and a molecular weight of 565.42 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989472 |
| Molecular Formula | C19H35F3IN5O3 |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N/CCC(O)(c1nccn1C)C(F)(F)F)NCC.I |
| InChI | InChI=1S/C19H34F3N5O3.HI/c1-4-6-12-29-14-15-30-13-10-26-17(23-5-2)25-8-7-18(28,19(20,21)22)16-24-9-11-27(16)3;/h9,11,28H,4-8,10,12-15H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | YSSLELARAYULQA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|