C19H31F3IN5O — CID 111209761
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111209761) has the molecular formula C19H31F3IN5O and a molecular weight of 529.39 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111209761 |
| Molecular Formula | C19H31F3IN5O |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C19H30F3N5O.HI/c1-3-23-17(25-11-9-15-7-5-4-6-8-15)26-12-10-18(28,19(20,21)22)16-24-13-14-27(16)2;/h7,13-14,28H,3-6,8-12H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | XYFYKOVENHDMLL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|