C15H26F3N5O — CID 111179322
1-ethyl-2-(2-methylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111179322) has the molecular formula C15H26F3N5O and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-ethyl-2-(2-methylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-2-(2-methylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111179322 |
| Molecular Formula | C15H26F3N5O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 1-ethyl-2-(2-methylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C)C)NCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C15H26F3N5O/c1-5-19-13(22-10-11(2)3)21-7-6-14(24,15(16,17)18)12-20-8-9-23(12)4/h8-9,11,24H,5-7,10H2,1-4H3,(H2,19,21,22) |
| InChIKey | IBBQLJRTPNBDCR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|