C16H29F3IN5OS — CID 111986920
1-ethyl-2-(2-methyl-2-methylsulfanylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111986920) has the molecular formula C16H29F3IN5OS and a molecular weight of 523.41 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-methylsulfanylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-methylsulfanylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111986920 |
| Molecular Formula | C16H29F3IN5OS |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-methylsulfanylpropyl)-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCC(O)(c1nccn1C)C(F)(F)F.I |
| InChI | InChI=1S/C16H28F3N5OS.HI/c1-6-20-13(23-11-14(2,3)26-5)22-8-7-15(25,16(17,18)19)12-21-9-10-24(12)4;/h9-10,25H,6-8,11H2,1-5H3,(H2,20,22,23);1H |
| InChIKey | DTABLHPBKFJQKX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|