C17H27F3N8O — CID 111989797
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111989797) has the molecular formula C17H27F3N8O and a molecular weight of 416.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111989797 |
| Molecular Formula | C17H27F3N8O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)NCCn1cnnc1CC |
| InChI | InChI=1S/C17H27F3N8O/c1-4-13-26-25-12-28(13)11-9-24-15(21-5-2)23-7-6-16(29,17(18,19)20)14-22-8-10-27(14)3/h8,10,12,29H,4-7,9,11H2,1-3H3,(H2,21,23,24) |
| InChIKey | UXHKPONPULXLSQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|