C13H26N6O — CID 111700631
2-(2-ethoxyethyl)-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111700631) has the molecular formula C13H26N6O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-(2-ethoxyethyl)-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111700631 |
| Molecular Formula | C13H26N6O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-(2-ethoxyethyl)-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCOCC)NCCn1cnnc1CC |
| InChI | InChI=1S/C13H26N6O/c1-4-12-18-17-11-19(12)9-7-15-13(14-5-2)16-8-10-20-6-3/h11H,4-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | FFSKMWQAGKVAIR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|