C13H27N7O2S — CID 111701521
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(methanesulfonamido)propyl]guanidine (PubChem CID 111701521) has the molecular formula C13H27N7O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(methanesulfonamido)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(methanesulfonamido)propyl]guanidine |
|---|---|
| PubChem CID | 111701521 |
| Molecular Formula | C13H27N7O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(methanesulfonamido)propyl]guanidine |
| SMILES | CCN/C(=N\CCCNS(C)(=O)=O)NCCn1cnnc1CC |
| InChI | InChI=1S/C13H27N7O2S/c1-4-12-19-17-11-20(12)10-9-16-13(14-5-2)15-7-6-8-18-23(3,21)22/h11,18H,4-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | DTQABXGOIJJCOB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|