C14H27N7O2S — CID 111700137
2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111700137) has the molecular formula C14H27N7O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111700137 |
| Molecular Formula | C14H27N7O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)NCCn1cnnc1CC |
| InChI | InChI=1S/C14H27N7O2S/c1-3-13-19-18-12-20(13)9-6-16-14(15-4-2)17-7-10-21-8-5-11-24(21,22)23/h12H,3-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | NXIKODAHIWLDPA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|