C15H27IN8 — CID 111699498
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111699498) has the molecular formula C15H27IN8 and a molecular weight of 446.34 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111699498 |
| Molecular Formula | C15H27IN8 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cnn(C)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C15H26N8.HI/c1-4-14-21-19-12-23(14)9-8-18-15(16-5-2)17-7-6-13-10-20-22(3)11-13;/h10-12H,4-9H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HNFPJEVYYUGDDS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|