C19H28N6O2 — CID 111700341
methyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]benzoate (PubChem CID 111700341) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is methyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 111700341 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]benzoate |
| SMILES | CCN/C(=N\CCc1ccc(C(=O)OC)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C19H28N6O2/c1-4-17-24-23-14-25(17)13-12-22-19(20-5-2)21-11-10-15-6-8-16(9-7-15)18(26)27-3/h6-9,14H,4-5,10-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | WXTKLTAXYLAZMX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|