C19H29IN6O2 — CID 111699124
ethyl 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111699124) has the molecular formula C19H29IN6O2 and a molecular weight of 500.39 g/mol. Its IUPAC name is ethyl 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | ethyl 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111699124 |
| Molecular Formula | C19H29IN6O2 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | ethyl 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)OCC)cc1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C19H28N6O2.HI/c1-4-17-24-23-14-25(17)12-11-21-19(20-5-2)22-13-15-7-9-16(10-8-15)18(26)27-6-3;/h7-10,14H,4-6,11-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | VOPIDXFPKSAKKZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|