C18H29N7O2S — CID 111699371
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111699371) has the molecular formula C18H29N7O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111699371 |
| Molecular Formula | C18H29N7O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C18H29N7O2S/c1-4-17-24-23-14-25(17)11-10-21-18(20-5-2)22-12-15-6-8-16(9-7-15)13-28(26,27)19-3/h6-9,14,19H,4-5,10-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | ZVGKDGBJNQLJNK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|