C18H29FIN7 — CID 111701598
2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111701598) has the molecular formula C18H29FIN7 and a molecular weight of 489.38 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111701598 |
| Molecular Formula | C18H29FIN7 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C)c(F)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H28FN7.HI/c1-5-17-24-23-13-26(17)10-9-21-18(20-6-2)22-12-14-7-8-16(25(3)4)15(19)11-14;/h7-8,11,13H,5-6,9-10,12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | CXARVLIDUXNZML-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|