C16H23BrFIN6 — CID 111699068
2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111699068) has the molecular formula C16H23BrFIN6 and a molecular weight of 525.21 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111699068 |
| Molecular Formula | C16H23BrFIN6 |
| Molecular Weight | 525.21 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)cc(Br)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C16H22BrFN6.HI/c1-3-15-23-22-11-24(15)6-5-20-16(19-4-2)21-10-12-7-13(17)9-14(18)8-12;/h7-9,11H,3-6,10H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | VYHZFAJZOZYKAW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|