C17H25N7O — CID 111698398
4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 111698398) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111698398 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C17H25N7O/c1-3-15-23-22-12-24(15)10-9-20-17(19-4-2)21-11-13-5-7-14(8-6-13)16(18)25/h5-8,12H,3-4,9-11H2,1-2H3,(H2,18,25)(H2,19,20,21) |
| InChIKey | RRJACCGPXTVGJQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|