C21H34N6O — CID 111701183
2-[2-(4-butoxyphenyl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111701183) has the molecular formula C21H34N6O and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[2-(4-butoxyphenyl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(4-butoxyphenyl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111701183 |
| Molecular Formula | C21H34N6O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[2-(4-butoxyphenyl)ethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCCCOc1ccc(CC/N=C(\NCC)NCCn2cnnc2CC)cc1 |
| InChI | InChI=1S/C21H34N6O/c1-4-7-16-28-19-10-8-18(9-11-19)12-13-23-21(22-6-3)24-14-15-27-17-25-26-20(27)5-2/h8-11,17H,4-7,12-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | ZORMIENEOCMBBE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|