C19H29ClN6 — CID 111512077
2-butyl-1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111512077) has the molecular formula C19H29ClN6 and a molecular weight of 376.94 g/mol. Its IUPAC name is 2-butyl-1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-butyl-1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111512077 |
| Molecular Formula | C19H29ClN6 |
| Molecular Weight | 376.94 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-butyl-1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCCC/N=C(/NCCc1ccc(Cl)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C19H29ClN6/c1-3-5-11-21-19(22-12-10-16-6-8-17(20)9-7-16)23-13-14-26-15-24-25-18(26)4-2/h6-9,15H,3-5,10-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | PCYVDGBKBWRJNA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|