C18H26ClIN6 — CID 111510487
2-[(4-chlorophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111510487) has the molecular formula C18H26ClIN6 and a molecular weight of 488.81 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111510487 |
| Molecular Formula | C18H26ClIN6 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(=N\Cc1ccc(Cl)cc1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H25ClN6.HI/c1-4-17-24-23-13-25(17)10-9-20-18(21-11-14(2)3)22-12-15-5-7-16(19)8-6-15;/h5-8,13H,2,4,9-12H2,1,3H3,(H2,20,21,22);1H |
| InChIKey | GVILSRFUSYTDCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|