C17H25IN6 — CID 111492729
2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111492729) has the molecular formula C17H25IN6 and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111492729 |
| Molecular Formula | C17H25IN6 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-benzyl-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccccc1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C17H24N6.HI/c1-3-10-18-17(20-13-15-8-6-5-7-9-15)19-11-12-23-14-21-22-16(23)4-2;/h3,5-9,14H,1,4,10-13H2,2H3,(H2,18,19,20);1H |
| InChIKey | XXODPTJQIPUSRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|