C18H24F3IN6 — CID 111495257
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111495257) has the molecular formula C18H24F3IN6 and a molecular weight of 508.33 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111495257 |
| Molecular Formula | C18H24F3IN6 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C18H23F3N6.HI/c1-3-8-22-17(23-9-10-27-13-25-26-16(27)4-2)24-12-14-6-5-7-15(11-14)18(19,20)21;/h3,5-7,11,13H,1,4,8-10,12H2,2H3,(H2,22,23,24);1H |
| InChIKey | BZWHQPAZJZDIDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|