C17H26IN7 — CID 136924568
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 136924568) has the molecular formula C17H26IN7 and a molecular weight of 455.35 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 136924568 |
| Molecular Formula | C17H26IN7 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-prop-2-enyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\CCc1ccccn1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C17H25N7.HI/c1-3-9-19-17(20-11-8-15-7-5-6-10-18-15)21-12-13-24-14-22-23-16(24)4-2;/h3,5-7,10,14H,1,4,8-9,11-13H2,2H3,(H2,19,20,21);1H |
| InChIKey | IUROPRDOSYGHGI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|