C21H30N8 — CID 136923663
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-prop-2-enylguanidine (PubChem CID 136923663) has the molecular formula C21H30N8 and a molecular weight of 394.53 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-prop-2-enylguanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136923663 |
| Molecular Formula | C21H30N8 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H30N8/c1-4-11-22-21(24-13-15-28-16-25-27-20(28)5-2)23-12-8-14-29-17(3)26-18-9-6-7-10-19(18)29/h4,6-7,9-10,16H,1,5,8,11-15H2,2-3H3,(H2,22,23,24) |
| InChIKey | ZPYWTHSEISJKLZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|