C19H33N7O — CID 136923661
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-oxoazepan-1-yl)propyl]-3-prop-2-enylguanidine (PubChem CID 136923661) has the molecular formula C19H33N7O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-oxoazepan-1-yl)propyl]-3-prop-2-enylguanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-oxoazepan-1-yl)propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136923661 |
| Molecular Formula | C19H33N7O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-oxoazepan-1-yl)propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CCCN1CCCCCC1=O)NCCn1cnnc1CC |
| InChI | InChI=1S/C19H33N7O/c1-3-10-20-19(22-12-15-26-16-23-24-17(26)4-2)21-11-8-14-25-13-7-5-6-9-18(25)27/h3,16H,1,4-15H2,2H3,(H2,20,21,22) |
| InChIKey | FQSMURSTMAZMTA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|