C20H40IN7 — CID 111518004
1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111518004) has the molecular formula C20H40IN7 and a molecular weight of 505.49 g/mol. Its IUPAC name is 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518004 |
| Molecular Formula | C20H40IN7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 1-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[3-(2-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\CCCN1CCCCC1C)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C20H39N7.HI/c1-4-6-11-21-20(23-13-16-27-17-24-25-19(27)5-2)22-12-9-15-26-14-8-7-10-18(26)3;/h17-18H,4-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | PVDHMPJSZJWJFI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|