C18H34N8O — CID 111699719
1-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide (PubChem CID 111699719) has the molecular formula C18H34N8O and a molecular weight of 378.53 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111699719 |
| Molecular Formula | C18H34N8O |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 1-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC(C(N)=O)C1)NCCn1cnnc1CC |
| InChI | InChI=1S/C18H34N8O/c1-3-16-24-23-14-26(16)12-9-22-18(20-4-2)21-8-6-11-25-10-5-7-15(13-25)17(19)27/h14-15H,3-13H2,1-2H3,(H2,19,27)(H2,20,21,22) |
| InChIKey | QFZSAGCQBYMJRP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|