C20H32FN5O — CID 111395521
1-[3-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide (PubChem CID 111395521) has the molecular formula C20H32FN5O and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111395521 |
| Molecular Formula | C20H32FN5O |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1-[3-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC(C(N)=O)C1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C20H32FN5O/c1-2-23-20(25-11-9-16-6-3-8-18(21)14-16)24-10-5-13-26-12-4-7-17(15-26)19(22)27/h3,6,8,14,17H,2,4-5,7,9-13,15H2,1H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | DBZZZGXLSRNOAC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|