C18H28FIN4O — CID 111147042
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111147042) has the molecular formula C18H28FIN4O and a molecular weight of 462.35 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111147042 |
| Molecular Formula | C18H28FIN4O |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C18H27FN4O.HI/c1-2-20-18(21-10-5-13-23-12-4-8-17(23)24)22-11-9-15-6-3-7-16(19)14-15;/h3,6-7,14H,2,4-5,8-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | NBELHOSOFWBKFS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|