C18H26Cl2N4O — CID 111148042
1-[2-(3,5-dichlorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111148042) has the molecular formula C18H26Cl2N4O and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111148042 |
| Molecular Formula | C18H26Cl2N4O |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H26Cl2N4O/c1-2-21-18(22-7-4-10-24-9-3-5-17(24)25)23-8-6-14-11-15(19)13-16(20)12-14/h11-13H,2-10H2,1H3,(H2,21,22,23) |
| InChIKey | FLKLUFKRMLQBBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|