C19H28ClN5O2 — CID 111146367
2-chloro-N-[2-[[N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111146367) has the molecular formula C19H28ClN5O2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111146367 |
| Molecular Formula | C19H28ClN5O2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[3-(2-oxopyrrolidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H28ClN5O2/c1-2-21-19(23-10-6-14-25-13-5-9-17(25)26)24-12-11-22-18(27)15-7-3-4-8-16(15)20/h3-4,7-8H,2,5-6,9-14H2,1H3,(H,22,27)(H2,21,23,24) |
| InChIKey | MJFFPHMUNHGSQP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|