C21H34ClN5O — CID 111387233
2-chloro-N-[2-[[N-ethyl-N'-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111387233) has the molecular formula C21H34ClN5O and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111387233 |
| Molecular Formula | C21H34ClN5O |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[3-(4-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCCN1CCC(C)CC1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H34ClN5O/c1-3-23-21(25-11-6-14-27-15-9-17(2)10-16-27)26-13-12-24-20(28)18-7-4-5-8-19(18)22/h4-5,7-8,17H,3,6,9-16H2,1-2H3,(H,24,28)(H2,23,25,26) |
| InChIKey | OAKHXAFDEJKRNB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|