C21H37N5O2 — CID 111776268
N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]-3-methylfuran-2-carboxamide (PubChem CID 111776268) has the molecular formula C21H37N5O2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111776268 |
| Molecular Formula | C21H37N5O2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1occc1C)NCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C21H37N5O2/c1-4-22-21(25-12-6-13-26-14-7-17(2)8-15-26)24-11-5-10-23-20(27)19-18(3)9-16-28-19/h9,16-17H,4-8,10-15H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | QDISQSWYRPVRDN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|